C14H13N3O4 — CID 103542771
6-amino-N-(6-methoxy-3-pyridinyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 103542771) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 6-amino-N-(6-methoxy-3-pyridinyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-(6-methoxy-3-pyridinyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 103542771 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 6-amino-N-(6-methoxy-3-pyridinyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3c(cc2N)OCO3)cn1 |
| InChI | InChI=1S/C14H13N3O4/c1-19-13-3-2-8(6-16-13)17-14(18)9-4-11-12(5-10(9)15)21-7-20-11/h2-6H,7,15H2,1H3,(H,17,18) |
| InChIKey | PLWURDXZPKWEPH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|