C14H13N3O3 — CID 103542804
6-amino-N-(4-methyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 103542804) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 6-amino-N-(4-methyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-(4-methyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 103542804 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 6-amino-N-(4-methyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ccnc(NC(=O)c2cc3c(cc2N)OCO3)c1 |
| InChI | InChI=1S/C14H13N3O3/c1-8-2-3-16-13(4-8)17-14(18)9-5-11-12(6-10(9)15)20-7-19-11/h2-6H,7,15H2,1H3,(H,16,17,18) |
| InChIKey | RPRIIAUXRHPJOY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|