C14H16N4O3 — CID 103543383
6-amino-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 103543383) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 6-amino-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 103543383 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 6-amino-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)c1cc(NC(=O)c2cc3c(cc2N)OCO3)n[nH]1 |
| InChI | InChI=1S/C14H16N4O3/c1-7(2)10-5-13(18-17-10)16-14(19)8-3-11-12(4-9(8)15)21-6-20-11/h3-5,7H,6,15H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | ZTZHRWVYVZSGIR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|