C9H8N6O3 — CID 13267897
6-amino-N-(2H-tetrazol-5-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 13267897) has the molecular formula C9H8N6O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is 6-amino-N-(2H-tetrazol-5-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-(2H-tetrazol-5-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 13267897 |
| Molecular Formula | C9H8N6O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 6-amino-N-(2H-tetrazol-5-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Nc1cc2c(cc1C(=O)Nc1nn[nH]n1)OCO2 |
| InChI | InChI=1S/C9H8N6O3/c10-5-2-7-6(17-3-18-7)1-4(5)8(16)11-9-12-14-15-13-9/h1-2H,3,10H2,(H2,11,12,13,14,15,16) |
| InChIKey | ASFJCXAWEPFWMT-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|