C8H7N5O2 — CID 28643013
6-(2H-tetrazol-5-yl)-1,3-benzodioxol-5-amine (PubChem CID 28643013) has the molecular formula C8H7N5O2 and a molecular weight of 205.18 g/mol. Its IUPAC name is 6-(2H-tetrazol-5-yl)-1,3-benzodioxol-5-amine.
| Compound Name | 6-(2H-tetrazol-5-yl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 28643013 |
| Molecular Formula | C8H7N5O2 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 6-(2H-tetrazol-5-yl)-1,3-benzodioxol-5-amine |
| SMILES | Nc1cc2c(cc1-c1nn[nH]n1)OCO2 |
| InChI | InChI=1S/C8H7N5O2/c9-5-2-7-6(14-3-15-7)1-4(5)8-10-12-13-11-8/h1-2H,3,9H2,(H,10,11,12,13) |
| InChIKey | YRDGIBYWECXVCR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|