C11H11N5O3 — CID 60911386
N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 60911386) has the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. Its IUPAC name is N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 60911386 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(NC(=O)c1ccc2c(c1)OCO2)c1nn[nH]n1 |
| InChI | InChI=1S/C11H11N5O3/c1-6(10-13-15-16-14-10)12-11(17)7-2-3-8-9(4-7)19-5-18-8/h2-4,6H,5H2,1H3,(H,12,17)(H,13,14,15,16) |
| InChIKey | RHTQGHBAQSASLS-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |