C7H12N2O4 — CID 175096617
1,3-benzodioxole-5,6-diamine;dihydrate (PubChem CID 175096617) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 1,3-benzodioxole-5,6-diamine;dihydrate.
| Compound Name | 1,3-benzodioxole-5,6-diamine;dihydrate |
|---|---|
| PubChem CID | 175096617 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1,3-benzodioxole-5,6-diamine;dihydrate |
| SMILES | Nc1cc2c(cc1N)OCO2.O.O |
| InChI | InChI=1S/C7H8N2O2.2H2O/c8-4-1-6-7(2-5(4)9)11-3-10-6;;/h1-2H,3,8-9H2;2*1H2 |
| InChIKey | CXMAIGBGVRJNPY-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|