C14H14ClF3N4O2 — CID 157094804
1,3-benzodioxole-5,6-diamine;4-chloro-5-(trifluoromethyl)benzene-1,2-diamine (PubChem CID 157094804) has the molecular formula C14H14ClF3N4O2 and a molecular weight of 362.74 g/mol. Its IUPAC name is 1,3-benzodioxole-5,6-diamine;4-chloro-5-(trifluoromethyl)benzene-1,2-diamine.
| Compound Name | 1,3-benzodioxole-5,6-diamine;4-chloro-5-(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 157094804 |
| Molecular Formula | C14H14ClF3N4O2 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1,3-benzodioxole-5,6-diamine;4-chloro-5-(trifluoromethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(Cl)c(C(F)(F)F)cc1N.Nc1cc2c(cc1N)OCO2 |
| InChI | InChI=1S/C7H6ClF3N2.C7H8N2O2/c8-4-2-6(13)5(12)1-3(4)7(9,10)11;8-4-1-6-7(2-5(4)9)11-3-10-6/h1-2H,12-13H2;1-2H,3,8-9H2 |
| InChIKey | AFBUETSSDKFJLE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|