C9H8F3NO3 — CID 19431146
6-(2,2,2-trifluoroethoxy)-1,3-benzodioxol-5-amine (PubChem CID 19431146) has the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. Its IUPAC name is 6-(2,2,2-trifluoroethoxy)-1,3-benzodioxol-5-amine.
| Compound Name | 6-(2,2,2-trifluoroethoxy)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 19431146 |
| Molecular Formula | C9H8F3NO3 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 6-(2,2,2-trifluoroethoxy)-1,3-benzodioxol-5-amine |
| SMILES | Nc1cc2c(cc1OCC(F)(F)F)OCO2 |
| InChI | InChI=1S/C9H8F3NO3/c10-9(11,12)3-14-6-2-8-7(1-5(6)13)15-4-16-8/h1-2H,3-4,13H2 |
| InChIKey | VSMPCEPXHNSOEG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|