C9H10F3NO2 — CID 16777766
5-methoxy-2-(2,2,2-trifluoroethoxy)aniline (PubChem CID 16777766) has the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. Its IUPAC name is 5-methoxy-2-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | 5-methoxy-2-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 16777766 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-methoxy-2-(2,2,2-trifluoroethoxy)aniline |
| SMILES | COc1ccc(OCC(F)(F)F)c(N)c1 |
| InChI | InChI=1S/C9H10F3NO2/c1-14-6-2-3-8(7(13)4-6)15-5-9(10,11)12/h2-4H,5,13H2,1H3 |
| InChIKey | WYIZPHDLKDPPJX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|