C12H13N3O2 — CID 70450915
2,5-diazabicyclo[2.2.0]hexa-1(6),2,4-triene;2,5-dimethoxyaniline (PubChem CID 70450915) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is 2,5-diazabicyclo[2.2.0]hexa-1(6),2,4-triene;2,5-dimethoxyaniline.
| Compound Name | 2,5-diazabicyclo[2.2.0]hexa-1(6),2,4-triene;2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 70450915 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2,5-diazabicyclo[2.2.0]hexa-1(6),2,4-triene;2,5-dimethoxyaniline |
| SMILES | COc1ccc(OC)c(N)c1.c1nc2cnc1-2 |
| InChI | InChI=1S/C8H11NO2.C4H2N2/c1-10-6-3-4-8(11-2)7(9)5-6;1-3-4(5-1)2-6-3/h3-5H,9H2,1-2H3;1-2H |
| InChIKey | ZBPFPWPVOQTIAB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|