C8H13NO2 — CID 159599481
2,5-dimethoxyaniline;molecular hydrogen (PubChem CID 159599481) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 2,5-dimethoxyaniline;molecular hydrogen.
| Compound Name | 2,5-dimethoxyaniline;molecular hydrogen |
|---|---|
| PubChem CID | 159599481 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 2,5-dimethoxyaniline;molecular hydrogen |
| SMILES | COc1ccc(OC)c(N)c1.[H][H] |
| InChI | InChI=1S/C8H11NO2.H2/c1-10-6-3-4-8(11-2)7(9)5-6;/h3-5H,9H2,1-2H3;1H |
| InChIKey | MLGZVGSAJKTSIN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|