C15H16BrNO4 — CID 104706561
2-(2-bromo-4-methoxyphenoxy)-4,5-dimethoxyaniline (PubChem CID 104706561) has the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. Its IUPAC name is 2-(2-bromo-4-methoxyphenoxy)-4,5-dimethoxyaniline.
| Compound Name | 2-(2-bromo-4-methoxyphenoxy)-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 104706561 |
| Molecular Formula | C15H16BrNO4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-(2-bromo-4-methoxyphenoxy)-4,5-dimethoxyaniline |
| SMILES | COc1ccc(Oc2cc(OC)c(OC)cc2N)c(Br)c1 |
| InChI | InChI=1S/C15H16BrNO4/c1-18-9-4-5-12(10(16)6-9)21-13-8-15(20-3)14(19-2)7-11(13)17/h4-8H,17H2,1-3H3 |
| InChIKey | NKCWMPWSQLWHAA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|