C15H17F3N2O2 — CID 159455621
2,5-dimethoxyaniline;3-(trifluoromethyl)aniline (PubChem CID 159455621) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is 2,5-dimethoxyaniline;3-(trifluoromethyl)aniline.
| Compound Name | 2,5-dimethoxyaniline;3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 159455621 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2,5-dimethoxyaniline;3-(trifluoromethyl)aniline |
| SMILES | COc1ccc(OC)c(N)c1.Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H11NO2.C7H6F3N/c1-10-6-3-4-8(11-2)7(9)5-6;8-7(9,10)5-2-1-3-6(11)4-5/h3-5H,9H2,1-2H3;1-4H,11H2 |
| InChIKey | LTXXOHLOQWCVKX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|