C10H11F3O3 — CID 43268000
[5-methoxy-2-(2,2,2-trifluoroethoxy)phenyl]methanol (PubChem CID 43268000) has the molecular formula C10H11F3O3 and a molecular weight of 236.19 g/mol. Its IUPAC name is [5-methoxy-2-(2,2,2-trifluoroethoxy)phenyl]methanol.
| Compound Name | [5-methoxy-2-(2,2,2-trifluoroethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 43268000 |
| Molecular Formula | C10H11F3O3 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [5-methoxy-2-(2,2,2-trifluoroethoxy)phenyl]methanol |
| SMILES | COc1ccc(OCC(F)(F)F)c(CO)c1 |
| InChI | InChI=1S/C10H11F3O3/c1-15-8-2-3-9(7(4-8)5-14)16-6-10(11,12)13/h2-4,14H,5-6H2,1H3 |
| InChIKey | BHMBXIXPEVDTTL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |