C12H14O3 — CID 43268037
(2-but-3-ynoxy-5-methoxyphenyl)methanol (PubChem CID 43268037) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2-but-3-ynoxy-5-methoxyphenyl)methanol.
| Compound Name | (2-but-3-ynoxy-5-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 43268037 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2-but-3-ynoxy-5-methoxyphenyl)methanol |
| SMILES | C#CCCOc1ccc(OC)cc1CO |
| InChI | InChI=1S/C12H14O3/c1-3-4-7-15-12-6-5-11(14-2)8-10(12)9-13/h1,5-6,8,13H,4,7,9H2,2H3 |
| InChIKey | RLENGUITTNINNA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|