C11H16O5S — CID 60915794
[5-methoxy-2-(2-methylsulfonylethoxy)phenyl]methanol (PubChem CID 60915794) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is [5-methoxy-2-(2-methylsulfonylethoxy)phenyl]methanol.
| Compound Name | [5-methoxy-2-(2-methylsulfonylethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 60915794 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | [5-methoxy-2-(2-methylsulfonylethoxy)phenyl]methanol |
| SMILES | COc1ccc(OCCS(C)(=O)=O)c(CO)c1 |
| InChI | InChI=1S/C11H16O5S/c1-15-10-3-4-11(9(7-10)8-12)16-5-6-17(2,13)14/h3-4,7,12H,5-6,8H2,1-2H3 |
| InChIKey | JNNGLJDBSXTUGS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |