C12H15NO3 — CID 43267979
4-[2-(hydroxymethyl)-4-methoxyphenoxy]butanenitrile (PubChem CID 43267979) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-[2-(hydroxymethyl)-4-methoxyphenoxy]butanenitrile.
| Compound Name | 4-[2-(hydroxymethyl)-4-methoxyphenoxy]butanenitrile |
|---|---|
| PubChem CID | 43267979 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 4-[2-(hydroxymethyl)-4-methoxyphenoxy]butanenitrile |
| SMILES | COc1ccc(OCCCC#N)c(CO)c1 |
| InChI | InChI=1S/C12H15NO3/c1-15-11-4-5-12(10(8-11)9-14)16-7-3-2-6-13/h4-5,8,14H,2-3,7,9H2,1H3 |
| InChIKey | ZYVBFFWALMCHGX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|