C14H23NO3 — CID 43267964
[2-[2-(diethylamino)ethoxy]-5-methoxyphenyl]methanol (PubChem CID 43267964) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is [2-[2-(diethylamino)ethoxy]-5-methoxyphenyl]methanol.
| Compound Name | [2-[2-(diethylamino)ethoxy]-5-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 43267964 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | [2-[2-(diethylamino)ethoxy]-5-methoxyphenyl]methanol |
| SMILES | CCN(CC)CCOc1ccc(OC)cc1CO |
| InChI | InChI=1S/C14H23NO3/c1-4-15(5-2)8-9-18-14-7-6-13(17-3)10-12(14)11-16/h6-7,10,16H,4-5,8-9,11H2,1-3H3 |
| InChIKey | ODBWFDQCCKWQNL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |