C19H25NO4 — CID 54265250
4-[2-(diethylamino)ethoxy]-6-methoxy-1-methylnaphthalene-2-carboxylic acid (PubChem CID 54265250) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethoxy]-6-methoxy-1-methylnaphthalene-2-carboxylic acid.
| Compound Name | 4-[2-(diethylamino)ethoxy]-6-methoxy-1-methylnaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 54265250 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-[2-(diethylamino)ethoxy]-6-methoxy-1-methylnaphthalene-2-carboxylic acid |
| SMILES | CCN(CC)CCOc1cc(C(=O)O)c(C)c2ccc(OC)cc12 |
| InChI | InChI=1S/C19H25NO4/c1-5-20(6-2)9-10-24-18-12-16(19(21)22)13(3)15-8-7-14(23-4)11-17(15)18/h7-8,11-12H,5-6,9-10H2,1-4H3,(H,21,22) |
| InChIKey | RGHLFFNITLHUFP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |