C14H24N2O2 — CID 43268159
2-[2-(aminomethyl)-4-methoxyphenoxy]-N,N-diethylethanamine (PubChem CID 43268159) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-4-methoxyphenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[2-(aminomethyl)-4-methoxyphenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 43268159 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-[2-(aminomethyl)-4-methoxyphenoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc(OC)cc1CN |
| InChI | InChI=1S/C14H24N2O2/c1-4-16(5-2)8-9-18-14-7-6-13(17-3)10-12(14)11-15/h6-7,10H,4-5,8-9,11,15H2,1-3H3 |
| InChIKey | PXMHSIAHPTWUQR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |