C13H22N2O — CID 16787209
2-[2-(aminomethyl)phenoxy]-N,N-diethylethanamine (PubChem CID 16787209) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-[2-(aminomethyl)phenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[2-(aminomethyl)phenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 16787209 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-[2-(aminomethyl)phenoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccccc1CN |
| InChI | InChI=1S/C13H22N2O/c1-3-15(4-2)9-10-16-13-8-6-5-7-12(13)11-14/h5-8H,3-4,9-11,14H2,1-2H3 |
| InChIKey | QKTZEXRCEPPMOB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |