C24H31N3O4 — CID 167866171
N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-5-methoxy-2-methyl-1H-indole-3-carboxamide (PubChem CID 167866171) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-5-methoxy-2-methyl-1H-indole-3-carboxamide.
| Compound Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-5-methoxy-2-methyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 167866171 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-5-methoxy-2-methyl-1H-indole-3-carboxamide |
| SMILES | CCN(CC)CCOc1cc(NC(=O)c2c(C)[nH]c3ccc(OC)cc23)ccc1OC |
| InChI | InChI=1S/C24H31N3O4/c1-6-27(7-2)12-13-31-22-14-17(8-11-21(22)30-5)26-24(28)23-16(3)25-20-10-9-18(29-4)15-19(20)23/h8-11,14-15,25H,6-7,12-13H2,1-5H3,(H,26,28) |
| InChIKey | NZBAKLLXYCZWTR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |