C26H30N2O3 — CID 56988348
N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-4-phenylbenzamide (PubChem CID 56988348) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-4-phenylbenzamide.
| Compound Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 56988348 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-4-phenylbenzamide |
| SMILES | CCN(CC)CCOc1cc(NC(=O)c2ccc(-c3ccccc3)cc2)ccc1OC |
| InChI | InChI=1S/C26H30N2O3/c1-4-28(5-2)17-18-31-25-19-23(15-16-24(25)30-3)27-26(29)22-13-11-21(12-14-22)20-9-7-6-8-10-20/h6-16,19H,4-5,17-18H2,1-3H3,(H,27,29) |
| InChIKey | RPOBCLJBHVBNIA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |