C28H34N2O4 — CID 18672596
N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-4-(3-hydroxyphenyl)benzamide (PubChem CID 18672596) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-4-(3-hydroxyphenyl)benzamide.
| Compound Name | N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-4-(3-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 18672596 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-4-(3-hydroxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3cccc(O)c3)cc2)cc1OCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C28H34N2O4/c1-19(2)30(20(3)4)15-16-34-27-18-24(13-14-26(27)33-5)29-28(32)22-11-9-21(10-12-22)23-7-6-8-25(31)17-23/h6-14,17-20,31H,15-16H2,1-5H3,(H,29,32) |
| InChIKey | WEKAXZMMFKKHGV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |