C24H25N3O5 — CID 18672595
N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]-4-(3-nitrophenyl)benzamide (PubChem CID 18672595) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]-4-(3-nitrophenyl)benzamide.
| Compound Name | N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]-4-(3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 18672595 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]-4-(3-nitrophenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3cccc([N+](=O)[O-])c3)cc2)cc1OCCN(C)C |
| InChI | InChI=1S/C24H25N3O5/c1-26(2)13-14-32-23-16-20(11-12-22(23)31-3)25-24(28)18-9-7-17(8-10-18)19-5-4-6-21(15-19)27(29)30/h4-12,15-16H,13-14H2,1-3H3,(H,25,28) |
| InChIKey | LROMUGOTCKAJIE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|