C29H36N2O4 — CID 18672554
N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-4-(3-methoxyphenyl)benzamide (PubChem CID 18672554) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-4-(3-methoxyphenyl)benzamide.
| Compound Name | N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-4-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 18672554 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-4-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2ccc(C(=O)Nc3ccc(OC)c(OCCN(C(C)C)C(C)C)c3)cc2)c1 |
| InChI | InChI=1S/C29H36N2O4/c1-20(2)31(21(3)4)16-17-35-28-19-25(14-15-27(28)34-6)30-29(32)23-12-10-22(11-13-23)24-8-7-9-26(18-24)33-5/h7-15,18-21H,16-17H2,1-6H3,(H,30,32) |
| InChIKey | UJMZSDIMUQXSBI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |