C23H31N3O3 — CID 54439942
N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 54439942) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 54439942 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | COc1ccc(NC(=O)C=Cc2cccnc2)cc1OCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C23H31N3O3/c1-17(2)26(18(3)4)13-14-29-22-15-20(9-10-21(22)28-5)25-23(27)11-8-19-7-6-12-24-16-19/h6-12,15-18H,13-14H2,1-5H3,(H,25,27) |
| InChIKey | WNJZUGRFPXMBAU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|