C26H33N3O3 — CID 70144749
(E)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-(1H-indol-6-yl)prop-2-enamide (PubChem CID 70144749) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is (E)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-(1H-indol-6-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-(1H-indol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 70144749 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | (E)-N-[3-[2-[di(propan-2-yl)amino]ethoxy]-4-methoxyphenyl]-3-(1H-indol-6-yl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2ccc3cc[nH]c3c2)cc1OCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C26H33N3O3/c1-18(2)29(19(3)4)14-15-32-25-17-22(9-10-24(25)31-5)28-26(30)11-7-20-6-8-21-12-13-27-23(21)16-20/h6-13,16-19,27H,14-15H2,1-5H3,(H,28,30)/b11-7+ |
| InChIKey | DRBFMZQMDBJNBM-YRNVUSSQSA-N |
| XLogP | 5.33 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|