C23H27FN4O3 — CID 60610195
N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide (PubChem CID 60610195) has the molecular formula C23H27FN4O3 and a molecular weight of 426.49 g/mol. Its IUPAC name is N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide.
| Compound Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 60610195 |
| Molecular Formula | C23H27FN4O3 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide |
| SMILES | CCN(CC)CCOc1cc(NC(=O)c2ccn(-c3ccccc3F)n2)ccc1OC |
| InChI | InChI=1S/C23H27FN4O3/c1-4-27(5-2)14-15-31-22-16-17(10-11-21(22)30-3)25-23(29)19-12-13-28(26-19)20-9-7-6-8-18(20)24/h6-13,16H,4-5,14-15H2,1-3H3,(H,25,29) |
| InChIKey | FGBHYZYLMKHERK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |