C16H27N3O3 — CID 119865025
N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-2-(methylamino)acetamide (PubChem CID 119865025) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-2-(methylamino)acetamide.
| Compound Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 119865025 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-2-(methylamino)acetamide |
| SMILES | CCN(CC)CCOc1cc(NC(=O)CNC)ccc1OC |
| InChI | InChI=1S/C16H27N3O3/c1-5-19(6-2)9-10-22-15-11-13(7-8-14(15)21-4)18-16(20)12-17-3/h7-8,11,17H,5-6,9-10,12H2,1-4H3,(H,18,20) |
| InChIKey | FDNQGRXHEGNPIM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |