C22H30FN3O3 — CID 60612179
1-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-3-[2-(4-fluorophenyl)ethyl]urea (PubChem CID 60612179) has the molecular formula C22H30FN3O3 and a molecular weight of 403.50 g/mol. Its IUPAC name is 1-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-3-[2-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-3-[2-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 60612179 |
| Molecular Formula | C22H30FN3O3 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 1-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-3-[2-(4-fluorophenyl)ethyl]urea |
| SMILES | CCN(CC)CCOc1cc(NC(=O)NCCc2ccc(F)cc2)ccc1OC |
| InChI | InChI=1S/C22H30FN3O3/c1-4-26(5-2)14-15-29-21-16-19(10-11-20(21)28-3)25-22(27)24-13-12-17-6-8-18(23)9-7-17/h6-11,16H,4-5,12-15H2,1-3H3,(H2,24,25,27) |
| InChIKey | ZULCFMZAIJCCQY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |