C21H27FN2O3S — CID 47089567
N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-2-(2-fluorophenyl)sulfanylacetamide (PubChem CID 47089567) has the molecular formula C21H27FN2O3S and a molecular weight of 406.52 g/mol. Its IUPAC name is N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-2-(2-fluorophenyl)sulfanylacetamide.
| Compound Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-2-(2-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 47089567 |
| Molecular Formula | C21H27FN2O3S |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]-2-(2-fluorophenyl)sulfanylacetamide |
| SMILES | CCN(CC)CCOc1cc(NC(=O)CSc2ccccc2F)ccc1OC |
| InChI | InChI=1S/C21H27FN2O3S/c1-4-24(5-2)12-13-27-19-14-16(10-11-18(19)26-3)23-21(25)15-28-20-9-7-6-8-17(20)22/h6-11,14H,4-5,12-13,15H2,1-3H3,(H,23,25) |
| InChIKey | WJFGSKRBVNGGMB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |