C20H25BrN2O3S — CID 10366639
N-[3-[(2-bromophenyl)sulfanylmethoxy]-4-methoxyphenyl]-2-(diethylamino)acetamide (PubChem CID 10366639) has the molecular formula C20H25BrN2O3S and a molecular weight of 453.40 g/mol. Its IUPAC name is N-[3-[(2-bromophenyl)sulfanylmethoxy]-4-methoxyphenyl]-2-(diethylamino)acetamide.
| Compound Name | N-[3-[(2-bromophenyl)sulfanylmethoxy]-4-methoxyphenyl]-2-(diethylamino)acetamide |
|---|---|
| PubChem CID | 10366639 |
| Molecular Formula | C20H25BrN2O3S |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-[3-[(2-bromophenyl)sulfanylmethoxy]-4-methoxyphenyl]-2-(diethylamino)acetamide |
| SMILES | CCN(CC)CC(=O)Nc1ccc(OC)c(OCSc2ccccc2Br)c1 |
| InChI | InChI=1S/C20H25BrN2O3S/c1-4-23(5-2)13-20(24)22-15-10-11-17(25-3)18(12-15)26-14-27-19-9-7-6-8-16(19)21/h6-12H,4-5,13-14H2,1-3H3,(H,22,24) |
| InChIKey | LZQXSNRCUDXNSY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|