C19H19FN2O3S — CID 42392974
2-(2-fluorophenyl)sulfanyl-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]acetamide (PubChem CID 42392974) has the molecular formula C19H19FN2O3S and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 42392974 |
| Molecular Formula | C19H19FN2O3S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
| SMILES | COc1cc(NC(=O)CSc2ccccc2F)ccc1N1CCCC1=O |
| InChI | InChI=1S/C19H19FN2O3S/c1-25-16-11-13(8-9-15(16)22-10-4-7-19(22)24)21-18(23)12-26-17-6-3-2-5-14(17)20/h2-3,5-6,8-9,11H,4,7,10,12H2,1H3,(H,21,23) |
| InChIKey | PPCSJUIUOBOLRY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |