C24H20FN3O5S — CID 42396738
2-(2-fluorophenyl)sulfanyl-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-5-nitrobenzamide (PubChem CID 42396738) has the molecular formula C24H20FN3O5S and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-5-nitrobenzamide.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 42396738 |
| Molecular Formula | C24H20FN3O5S |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-5-nitrobenzamide |
| SMILES | COc1cc(NC(=O)c2cc([N+](=O)[O-])ccc2Sc2ccccc2F)ccc1N1CCCC1=O |
| InChI | InChI=1S/C24H20FN3O5S/c1-33-20-13-15(8-10-19(20)27-12-4-7-23(27)29)26-24(30)17-14-16(28(31)32)9-11-21(17)34-22-6-3-2-5-18(22)25/h2-3,5-6,8-11,13-14H,4,7,12H2,1H3,(H,26,30) |
| InChIKey | QTOYSUFNYCXXGW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|