C24H21N3O6 — CID 55758189
N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-5-nitro-2-phenoxybenzamide (PubChem CID 55758189) has the molecular formula C24H21N3O6 and a molecular weight of 447.45 g/mol. Its IUPAC name is N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-5-nitro-2-phenoxybenzamide.
| Compound Name | N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-5-nitro-2-phenoxybenzamide |
|---|---|
| PubChem CID | 55758189 |
| Molecular Formula | C24H21N3O6 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-5-nitro-2-phenoxybenzamide |
| SMILES | COc1cc(NC(=O)c2cc([N+](=O)[O-])ccc2Oc2ccccc2)ccc1N1CCCC1=O |
| InChI | InChI=1S/C24H21N3O6/c1-32-22-14-16(9-11-20(22)26-13-5-8-23(26)28)25-24(29)19-15-17(27(30)31)10-12-21(19)33-18-6-3-2-4-7-18/h2-4,6-7,9-12,14-15H,5,8,13H2,1H3,(H,25,29) |
| InChIKey | VXIFPDORMQEQPF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|