C11H11F3O4 — CID 138986364
methyl 3-(hydroxymethyl)-4-(2,2,2-trifluoroethoxy)benzoate (PubChem CID 138986364) has the molecular formula C11H11F3O4 and a molecular weight of 264.20 g/mol. Its IUPAC name is methyl 3-(hydroxymethyl)-4-(2,2,2-trifluoroethoxy)benzoate.
| Compound Name | methyl 3-(hydroxymethyl)-4-(2,2,2-trifluoroethoxy)benzoate |
|---|---|
| PubChem CID | 138986364 |
| Molecular Formula | C11H11F3O4 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | methyl 3-(hydroxymethyl)-4-(2,2,2-trifluoroethoxy)benzoate |
| SMILES | COC(=O)c1ccc(OCC(F)(F)F)c(CO)c1 |
| InChI | InChI=1S/C11H11F3O4/c1-17-10(16)7-2-3-9(8(4-7)5-15)18-6-11(12,13)14/h2-4,15H,5-6H2,1H3 |
| InChIKey | PJDYRMLEXTUCKX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |