C12H17F3O2Si — CID 121001825
[5-methoxy-2-(2,2,2-trifluoroethoxy)phenyl]-trimethylsilane (PubChem CID 121001825) has the molecular formula C12H17F3O2Si and a molecular weight of 278.35 g/mol. Its IUPAC name is [5-methoxy-2-(2,2,2-trifluoroethoxy)phenyl]-trimethylsilane.
| Compound Name | [5-methoxy-2-(2,2,2-trifluoroethoxy)phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 121001825 |
| Molecular Formula | C12H17F3O2Si |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [5-methoxy-2-(2,2,2-trifluoroethoxy)phenyl]-trimethylsilane |
| SMILES | COc1ccc(OCC(F)(F)F)c([Si](C)(C)C)c1 |
| InChI | InChI=1S/C12H17F3O2Si/c1-16-9-5-6-10(17-8-12(13,14)15)11(7-9)18(2,3)4/h5-7H,8H2,1-4H3 |
| InChIKey | SCEKCWGRWVOCGQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|