C9H9F4NO2 — CID 63599497
5-fluoro-4-methoxy-2-(2,2,2-trifluoroethoxy)aniline (PubChem CID 63599497) has the molecular formula C9H9F4NO2 and a molecular weight of 239.17 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-2-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | 5-fluoro-4-methoxy-2-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 63599497 |
| Molecular Formula | C9H9F4NO2 |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 5-fluoro-4-methoxy-2-(2,2,2-trifluoroethoxy)aniline |
| SMILES | COc1cc(OCC(F)(F)F)c(N)cc1F |
| InChI | InChI=1S/C9H9F4NO2/c1-15-7-3-8(6(14)2-5(7)10)16-4-9(11,12)13/h2-3H,4,14H2,1H3 |
| InChIKey | GEDODHGXERIXQU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|