C14H24N2O3 — CID 83007835
2-[2-(dimethylamino)-2-methylpropoxy]-4,5-dimethoxyaniline (PubChem CID 83007835) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-methylpropoxy]-4,5-dimethoxyaniline.
| Compound Name | 2-[2-(dimethylamino)-2-methylpropoxy]-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 83007835 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-[2-(dimethylamino)-2-methylpropoxy]-4,5-dimethoxyaniline |
| SMILES | COc1cc(N)c(OCC(C)(C)N(C)C)cc1OC |
| InChI | InChI=1S/C14H24N2O3/c1-14(2,16(3)4)9-19-11-8-13(18-6)12(17-5)7-10(11)15/h7-8H,9,15H2,1-6H3 |
| InChIKey | WKCOEHQHXDZZNS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|