C10H16N2O2 — CID 68606067
4,5-dimethoxy-2-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 68606067) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4,5-dimethoxy-2-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 4,5-dimethoxy-2-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 68606067 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4,5-dimethoxy-2-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | COc1cc(N)c(N(C)C)cc1OC |
| InChI | InChI=1S/C10H16N2O2/c1-12(2)8-6-10(14-4)9(13-3)5-7(8)11/h5-6H,11H2,1-4H3 |
| InChIKey | GKWVVCYJKXZCTP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|