C11H17FN2O — CID 63592378
4-fluoro-1-N,1-N-dimethyl-5-propan-2-yloxybenzene-1,2-diamine (PubChem CID 63592378) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is 4-fluoro-1-N,1-N-dimethyl-5-propan-2-yloxybenzene-1,2-diamine.
| Compound Name | 4-fluoro-1-N,1-N-dimethyl-5-propan-2-yloxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 63592378 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-fluoro-1-N,1-N-dimethyl-5-propan-2-yloxybenzene-1,2-diamine |
| SMILES | CC(C)Oc1cc(N(C)C)c(N)cc1F |
| InChI | InChI=1S/C11H17FN2O/c1-7(2)15-11-6-10(14(3)4)9(13)5-8(11)12/h5-7H,13H2,1-4H3 |
| InChIKey | YPNKCADOOQAOIX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|