C15H19FN2OS — CID 63593111
4-fluoro-1-N-methyl-5-propan-2-yloxy-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine (PubChem CID 63593111) has the molecular formula C15H19FN2OS and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-fluoro-1-N-methyl-5-propan-2-yloxy-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-1-N-methyl-5-propan-2-yloxy-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 63593111 |
| Molecular Formula | C15H19FN2OS |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-fluoro-1-N-methyl-5-propan-2-yloxy-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine |
| SMILES | CC(C)Oc1cc(N(C)Cc2ccsc2)c(N)cc1F |
| InChI | InChI=1S/C15H19FN2OS/c1-10(2)19-15-7-14(13(17)6-12(15)16)18(3)8-11-4-5-20-9-11/h4-7,9-10H,8,17H2,1-3H3 |
| InChIKey | RLCUEZIMMCSMRO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|