C13H12BrF3N2OS — CID 63594437
2-N-[(5-bromothiophen-3-yl)methyl]-4-(difluoromethoxy)-5-fluoro-2-N-methylbenzene-1,2-diamine (PubChem CID 63594437) has the molecular formula C13H12BrF3N2OS and a molecular weight of 381.22 g/mol. Its IUPAC name is 2-N-[(5-bromothiophen-3-yl)methyl]-4-(difluoromethoxy)-5-fluoro-2-N-methylbenzene-1,2-diamine.
| Compound Name | 2-N-[(5-bromothiophen-3-yl)methyl]-4-(difluoromethoxy)-5-fluoro-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 63594437 |
| Molecular Formula | C13H12BrF3N2OS |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 2-N-[(5-bromothiophen-3-yl)methyl]-4-(difluoromethoxy)-5-fluoro-2-N-methylbenzene-1,2-diamine |
| SMILES | CN(Cc1csc(Br)c1)c1cc(OC(F)F)c(F)cc1N |
| InChI | InChI=1S/C13H12BrF3N2OS/c1-19(5-7-2-12(14)21-6-7)10-4-11(20-13(16)17)8(15)3-9(10)18/h2-4,6,13H,5,18H2,1H3 |
| InChIKey | BAWIGZZFKCMUKP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|