C12H11BrClFN2S — CID 66078403
1-N-[(5-bromothiophen-3-yl)methyl]-4-chloro-5-fluoro-1-N-methylbenzene-1,2-diamine (PubChem CID 66078403) has the molecular formula C12H11BrClFN2S and a molecular weight of 349.66 g/mol. Its IUPAC name is 1-N-[(5-bromothiophen-3-yl)methyl]-4-chloro-5-fluoro-1-N-methylbenzene-1,2-diamine.
| Compound Name | 1-N-[(5-bromothiophen-3-yl)methyl]-4-chloro-5-fluoro-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 66078403 |
| Molecular Formula | C12H11BrClFN2S |
| Molecular Weight | 349.66 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 1-N-[(5-bromothiophen-3-yl)methyl]-4-chloro-5-fluoro-1-N-methylbenzene-1,2-diamine |
| SMILES | CN(Cc1csc(Br)c1)c1cc(F)c(Cl)cc1N |
| InChI | InChI=1S/C12H11BrClFN2S/c1-17(5-7-2-12(13)18-6-7)11-4-9(15)8(14)3-10(11)16/h2-4,6H,5,16H2,1H3 |
| InChIKey | DUSYTICSZRRELJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|