C15H18BrClN2S — CID 114861417
2-(2-aminopropyl)-N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N-methylaniline (PubChem CID 114861417) has the molecular formula C15H18BrClN2S and a molecular weight of 373.75 g/mol. Its IUPAC name is 2-(2-aminopropyl)-N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N-methylaniline.
| Compound Name | 2-(2-aminopropyl)-N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N-methylaniline |
|---|---|
| PubChem CID | 114861417 |
| Molecular Formula | C15H18BrClN2S |
| Molecular Weight | 373.75 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 2-(2-aminopropyl)-N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N-methylaniline |
| SMILES | CC(N)Cc1ccc(Cl)cc1N(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C15H18BrClN2S/c1-10(18)5-12-3-4-13(17)7-14(12)19(2)8-11-6-15(16)20-9-11/h3-4,6-7,9-10H,5,8,18H2,1-2H3 |
| InChIKey | HBIUWFDNRFIELK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.75 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |