C15H18Br2N2S — CID 63816184
2-(2-aminopropyl)-5-bromo-N-[(5-bromothiophen-3-yl)methyl]-N-methylaniline (PubChem CID 63816184) has the molecular formula C15H18Br2N2S and a molecular weight of 418.20 g/mol. Its IUPAC name is 2-(2-aminopropyl)-5-bromo-N-[(5-bromothiophen-3-yl)methyl]-N-methylaniline.
| Compound Name | 2-(2-aminopropyl)-5-bromo-N-[(5-bromothiophen-3-yl)methyl]-N-methylaniline |
|---|---|
| PubChem CID | 63816184 |
| Molecular Formula | C15H18Br2N2S |
| Molecular Weight | 418.20 g/mol |
| Exact Mass | 415.96 |
| IUPAC Name | 2-(2-aminopropyl)-5-bromo-N-[(5-bromothiophen-3-yl)methyl]-N-methylaniline |
| SMILES | CC(N)Cc1ccc(Br)cc1N(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C15H18Br2N2S/c1-10(18)5-12-3-4-13(16)7-14(12)19(2)8-11-6-15(17)20-9-11/h3-4,6-7,9-10H,5,8,18H2,1-2H3 |
| InChIKey | HYUCOMSGNRSYTO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.20 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |