C13H14BrNOS — CID 54982683
[2-[(5-bromothiophen-3-yl)methyl-methylamino]phenyl]methanol (PubChem CID 54982683) has the molecular formula C13H14BrNOS and a molecular weight of 312.23 g/mol. Its IUPAC name is [2-[(5-bromothiophen-3-yl)methyl-methylamino]phenyl]methanol.
| Compound Name | [2-[(5-bromothiophen-3-yl)methyl-methylamino]phenyl]methanol |
|---|---|
| PubChem CID | 54982683 |
| Molecular Formula | C13H14BrNOS |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | [2-[(5-bromothiophen-3-yl)methyl-methylamino]phenyl]methanol |
| SMILES | CN(Cc1csc(Br)c1)c1ccccc1CO |
| InChI | InChI=1S/C13H14BrNOS/c1-15(7-10-6-13(14)17-9-10)12-5-3-2-4-11(12)8-16/h2-6,9,16H,7-8H2,1H3 |
| InChIKey | HNASVMHXSJPBQZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |