C14H15BrClNOS — CID 63371224
(1R)-1-[4-[(5-bromothiophen-3-yl)methyl-methylamino]-3-chlorophenyl]ethanol (PubChem CID 63371224) has the molecular formula C14H15BrClNOS and a molecular weight of 360.70 g/mol. Its IUPAC name is (1R)-1-[4-[(5-bromothiophen-3-yl)methyl-methylamino]-3-chlorophenyl]ethanol.
| Compound Name | (1R)-1-[4-[(5-bromothiophen-3-yl)methyl-methylamino]-3-chlorophenyl]ethanol |
|---|---|
| PubChem CID | 63371224 |
| Molecular Formula | C14H15BrClNOS |
| Molecular Weight | 360.70 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | (1R)-1-[4-[(5-bromothiophen-3-yl)methyl-methylamino]-3-chlorophenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(N(C)Cc2csc(Br)c2)c(Cl)c1 |
| InChI | InChI=1S/C14H15BrClNOS/c1-9(18)11-3-4-13(12(16)6-11)17(2)7-10-5-14(15)19-8-10/h3-6,8-9,18H,7H2,1-2H3/t9-/m1/s1 |
| InChIKey | HPZPUPIDFGRYFJ-SECBINFHSA-N |
| XLogP | 4.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|